C15H22N2O — CID 82582832
N-cyclopentyl-5-methoxy-1,2,3,4-tetrahydroisoquinolin-8-amine (PubChem CID 82582832) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-cyclopentyl-5-methoxy-1,2,3,4-tetrahydroisoquinolin-8-amine.
| Compound Name | N-cyclopentyl-5-methoxy-1,2,3,4-tetrahydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 82582832 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-cyclopentyl-5-methoxy-1,2,3,4-tetrahydroisoquinolin-8-amine |
| SMILES | COc1ccc(NC2CCCC2)c2c1CCNC2 |
| InChI | InChI=1S/C15H22N2O/c1-18-15-7-6-14(17-11-4-2-3-5-11)13-10-16-9-8-12(13)15/h6-7,11,16-17H,2-5,8-10H2,1H3 |
| InChIKey | JIAPIZYXRRTNHQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|