C11H9N3O4 — CID 82589309
5-amino-1-(4-carboxyphenyl)pyrazole-3-carboxylic acid (PubChem CID 82589309) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-amino-1-(4-carboxyphenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-amino-1-(4-carboxyphenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82589309 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-amino-1-(4-carboxyphenyl)pyrazole-3-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)nn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H9N3O4/c12-9-5-8(11(17)18)13-14(9)7-3-1-6(2-4-7)10(15)16/h1-5H,12H2,(H,15,16)(H,17,18) |
| InChIKey | ROHVBXZFKRDXDL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |