C12H11N3O4 — CID 82589311
5-amino-1-[4-(carboxymethyl)phenyl]pyrazole-3-carboxylic acid (PubChem CID 82589311) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 5-amino-1-[4-(carboxymethyl)phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 5-amino-1-[4-(carboxymethyl)phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82589311 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-amino-1-[4-(carboxymethyl)phenyl]pyrazole-3-carboxylic acid |
| SMILES | Nc1cc(C(=O)O)nn1-c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C12H11N3O4/c13-10-6-9(12(18)19)14-15(10)8-3-1-7(2-4-8)5-11(16)17/h1-4,6H,5,13H2,(H,16,17)(H,18,19) |
| InChIKey | RVCKDYFCTJKRNI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |