C13H10N4O4 — CID 82589932
5-amino-1-[4-(carboxymethyl)phenyl]-4-cyanopyrazole-3-carboxylic acid (PubChem CID 82589932) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 5-amino-1-[4-(carboxymethyl)phenyl]-4-cyanopyrazole-3-carboxylic acid.
| Compound Name | 5-amino-1-[4-(carboxymethyl)phenyl]-4-cyanopyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82589932 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 5-amino-1-[4-(carboxymethyl)phenyl]-4-cyanopyrazole-3-carboxylic acid |
| SMILES | N#Cc1c(C(=O)O)nn(-c2ccc(CC(=O)O)cc2)c1N |
| InChI | InChI=1S/C13H10N4O4/c14-6-9-11(13(20)21)16-17(12(9)15)8-3-1-7(2-4-8)5-10(18)19/h1-4H,5,15H2,(H,18,19)(H,20,21) |
| InChIKey | UYKMSVQMOMVQIZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |