C12H9N5O4 — CID 82589934
5-amino-4-cyano-1-(2-methyl-5-nitrophenyl)pyrazole-3-carboxylic acid (PubChem CID 82589934) has the molecular formula C12H9N5O4 and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-amino-4-cyano-1-(2-methyl-5-nitrophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-amino-4-cyano-1-(2-methyl-5-nitrophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82589934 |
| Molecular Formula | C12H9N5O4 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-amino-4-cyano-1-(2-methyl-5-nitrophenyl)pyrazole-3-carboxylic acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-n1nc(C(=O)O)c(C#N)c1N |
| InChI | InChI=1S/C12H9N5O4/c1-6-2-3-7(17(20)21)4-9(6)16-11(14)8(5-13)10(15-16)12(18)19/h2-4H,14H2,1H3,(H,18,19) |
| InChIKey | PNERBAHJXCQMNW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|