C21H14N4O5 — CID 126199386
5-cyano-1-(2-methylphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid (PubChem CID 126199386) has the molecular formula C21H14N4O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is 5-cyano-1-(2-methylphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 5-cyano-1-(2-methylphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126199386 |
| Molecular Formula | C21H14N4O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 5-cyano-1-(2-methylphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
| SMILES | Cc1ccccc1-n1nc(C(=O)O)c(/C=C\c2ccc([N+](=O)[O-])cc2)c(C#N)c1=O |
| InChI | InChI=1S/C21H14N4O5/c1-13-4-2-3-5-18(13)24-20(26)17(12-22)16(19(23-24)21(27)28)11-8-14-6-9-15(10-7-14)25(29)30/h2-11H,1H3,(H,27,28)/b11-8- |
| InChIKey | DDBVOYJZMIXWNQ-FLIBITNWSA-N |
| XLogP | 3.19 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|