C20H12ClN3O3 — CID 126202121
4-[(Z)-2-(2-chlorophenyl)ethenyl]-5-cyano-6-oxo-1-phenylpyridazine-3-carboxylic acid (PubChem CID 126202121) has the molecular formula C20H12ClN3O3 and a molecular weight of 377.79 g/mol. Its IUPAC name is 4-[(Z)-2-(2-chlorophenyl)ethenyl]-5-cyano-6-oxo-1-phenylpyridazine-3-carboxylic acid.
| Compound Name | 4-[(Z)-2-(2-chlorophenyl)ethenyl]-5-cyano-6-oxo-1-phenylpyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126202121 |
| Molecular Formula | C20H12ClN3O3 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-[(Z)-2-(2-chlorophenyl)ethenyl]-5-cyano-6-oxo-1-phenylpyridazine-3-carboxylic acid |
| SMILES | N#Cc1c(/C=C\c2ccccc2Cl)c(C(=O)O)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H12ClN3O3/c21-17-9-5-4-6-13(17)10-11-15-16(12-22)19(25)24(23-18(15)20(26)27)14-7-2-1-3-8-14/h1-11H,(H,26,27)/b11-10- |
| InChIKey | RXRLUJQSQPDXJC-KHPPLWFESA-N |
| XLogP | 3.63 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|