C21H14FN3O4 — CID 126213193
5-cyano-4-[(Z)-2-(4-fluorophenyl)ethenyl]-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylic acid (PubChem CID 126213193) has the molecular formula C21H14FN3O4 and a molecular weight of 391.36 g/mol. Its IUPAC name is 5-cyano-4-[(Z)-2-(4-fluorophenyl)ethenyl]-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 5-cyano-4-[(Z)-2-(4-fluorophenyl)ethenyl]-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126213193 |
| Molecular Formula | C21H14FN3O4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-cyano-4-[(Z)-2-(4-fluorophenyl)ethenyl]-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C(=O)O)c(/C=C\c3ccc(F)cc3)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C21H14FN3O4/c1-29-16-9-7-15(8-10-16)25-20(26)18(12-23)17(19(24-25)21(27)28)11-4-13-2-5-14(22)6-3-13/h2-11H,1H3,(H,27,28)/b11-4- |
| InChIKey | XWIOILRJPGOJQP-WCIBSUBMSA-N |
| XLogP | 3.12 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|