C20H11BrClN3O3 — CID 126210492
4-[(Z)-2-(3-bromophenyl)ethenyl]-1-(4-chlorophenyl)-5-cyano-6-oxopyridazine-3-carboxylic acid (PubChem CID 126210492) has the molecular formula C20H11BrClN3O3 and a molecular weight of 456.68 g/mol. Its IUPAC name is 4-[(Z)-2-(3-bromophenyl)ethenyl]-1-(4-chlorophenyl)-5-cyano-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 4-[(Z)-2-(3-bromophenyl)ethenyl]-1-(4-chlorophenyl)-5-cyano-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126210492 |
| Molecular Formula | C20H11BrClN3O3 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 454.97 |
| IUPAC Name | 4-[(Z)-2-(3-bromophenyl)ethenyl]-1-(4-chlorophenyl)-5-cyano-6-oxopyridazine-3-carboxylic acid |
| SMILES | N#Cc1c(/C=C\c2cccc(Br)c2)c(C(=O)O)nn(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C20H11BrClN3O3/c21-13-3-1-2-12(10-13)4-9-16-17(11-23)19(26)25(24-18(16)20(27)28)15-7-5-14(22)6-8-15/h1-10H,(H,27,28)/b9-4- |
| InChIKey | FDYAOHNXJPNLQY-WTKPLQERSA-N |
| XLogP | 4.39 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|