C22H16N4O6 — CID 126204090
5-cyano-1-(4-ethoxyphenyl)-4-[(E)-2-(2-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid (PubChem CID 126204090) has the molecular formula C22H16N4O6 and a molecular weight of 432.39 g/mol. Its IUPAC name is 5-cyano-1-(4-ethoxyphenyl)-4-[(E)-2-(2-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 5-cyano-1-(4-ethoxyphenyl)-4-[(E)-2-(2-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126204090 |
| Molecular Formula | C22H16N4O6 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 5-cyano-1-(4-ethoxyphenyl)-4-[(E)-2-(2-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
| SMILES | CCOc1ccc(-n2nc(C(=O)O)c(/C=C/c3ccccc3[N+](=O)[O-])c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C22H16N4O6/c1-2-32-16-10-8-15(9-11-16)25-21(27)18(13-23)17(20(24-25)22(28)29)12-7-14-5-3-4-6-19(14)26(30)31/h3-12H,2H2,1H3,(H,28,29)/b12-7+ |
| InChIKey | QLWISCUSAJHMCP-KPKJPENVSA-N |
| XLogP | 3.28 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|