C21H14BrN3O3 — CID 126202814
4-[(Z)-2-(3-bromophenyl)ethenyl]-5-cyano-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid (PubChem CID 126202814) has the molecular formula C21H14BrN3O3 and a molecular weight of 436.27 g/mol. Its IUPAC name is 4-[(Z)-2-(3-bromophenyl)ethenyl]-5-cyano-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 4-[(Z)-2-(3-bromophenyl)ethenyl]-5-cyano-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126202814 |
| Molecular Formula | C21H14BrN3O3 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4-[(Z)-2-(3-bromophenyl)ethenyl]-5-cyano-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylic acid |
| SMILES | Cc1ccc(-n2nc(C(=O)O)c(/C=C\c3cccc(Br)c3)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C21H14BrN3O3/c1-13-5-8-16(9-6-13)25-20(26)18(12-23)17(19(24-25)21(27)28)10-7-14-3-2-4-15(22)11-14/h2-11H,1H3,(H,27,28)/b10-7- |
| InChIKey | WMVGKMYKQWDPNY-YFHOEESVSA-N |
| XLogP | 4.04 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|