C20H12N4O — CID 14381173
6-oxo-1-phenyl-4-[(E)-2-phenylethenyl]pyridazine-3,5-dicarbonitrile (PubChem CID 14381173) has the molecular formula C20H12N4O and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-oxo-1-phenyl-4-[(E)-2-phenylethenyl]pyridazine-3,5-dicarbonitrile.
| Compound Name | 6-oxo-1-phenyl-4-[(E)-2-phenylethenyl]pyridazine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 14381173 |
| Molecular Formula | C20H12N4O |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 6-oxo-1-phenyl-4-[(E)-2-phenylethenyl]pyridazine-3,5-dicarbonitrile |
| SMILES | N#Cc1nn(-c2ccccc2)c(=O)c(C#N)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H12N4O/c21-13-18-17(12-11-15-7-3-1-4-8-15)19(14-22)23-24(20(18)25)16-9-5-2-6-10-16/h1-12H/b12-11+ |
| InChIKey | HFNROVFVICCFIM-VAWYXSNFSA-N |
| XLogP | 3.15 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_F(3)', 'substructure': 'N/A'} |
|---|