C21H14N4O6 — CID 126208307
5-cyano-1-(4-methoxyphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid (PubChem CID 126208307) has the molecular formula C21H14N4O6 and a molecular weight of 418.37 g/mol. Its IUPAC name is 5-cyano-1-(4-methoxyphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 5-cyano-1-(4-methoxyphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126208307 |
| Molecular Formula | C21H14N4O6 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5-cyano-1-(4-methoxyphenyl)-4-[(Z)-2-(4-nitrophenyl)ethenyl]-6-oxopyridazine-3-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C(=O)O)c(/C=C\c3ccc([N+](=O)[O-])cc3)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C21H14N4O6/c1-31-16-9-7-14(8-10-16)24-20(26)18(12-22)17(19(23-24)21(27)28)11-4-13-2-5-15(6-3-13)25(29)30/h2-11H,1H3,(H,27,28)/b11-4- |
| InChIKey | ZIBBMOGIMAIVBZ-WCIBSUBMSA-N |
| XLogP | 2.89 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|