C16H15N3O4 — CID 2814242
methyl 5-cyano-4-ethyl-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylate (PubChem CID 2814242) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is methyl 5-cyano-4-ethyl-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | methyl 5-cyano-4-ethyl-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 2814242 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 5-cyano-4-ethyl-1-(4-methoxyphenyl)-6-oxopyridazine-3-carboxylate |
| SMILES | CCc1c(C(=O)OC)nn(-c2ccc(OC)cc2)c(=O)c1C#N |
| InChI | InChI=1S/C16H15N3O4/c1-4-12-13(9-17)15(20)19(18-14(12)16(21)23-3)10-5-7-11(22-2)8-6-10/h5-8H,4H2,1-3H3 |
| InChIKey | QEXKHQWLRCRKPO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|