C16H16N4O3 — CID 71238561
ethyl 5-cyano-4-methyl-1-[4-(methylamino)phenyl]-6-oxopyridazine-3-carboxylate (PubChem CID 71238561) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 5-cyano-4-methyl-1-[4-(methylamino)phenyl]-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 5-cyano-4-methyl-1-[4-(methylamino)phenyl]-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 71238561 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 5-cyano-4-methyl-1-[4-(methylamino)phenyl]-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(NC)cc2)c(=O)c(C#N)c1C |
| InChI | InChI=1S/C16H16N4O3/c1-4-23-16(22)14-10(2)13(9-17)15(21)20(19-14)12-7-5-11(18-3)6-8-12/h5-8,18H,4H2,1-3H3 |
| InChIKey | SMLRSXRFEZFWKA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'} |
|---|