C21H13ClN4O5 — CID 126205077
4-[(Z)-2-(2-chloro-5-nitrophenyl)ethenyl]-5-cyano-1-(3-methylphenyl)-6-oxopyridazine-3-carboxylic acid (PubChem CID 126205077) has the molecular formula C21H13ClN4O5 and a molecular weight of 436.81 g/mol. Its IUPAC name is 4-[(Z)-2-(2-chloro-5-nitrophenyl)ethenyl]-5-cyano-1-(3-methylphenyl)-6-oxopyridazine-3-carboxylic acid.
| Compound Name | 4-[(Z)-2-(2-chloro-5-nitrophenyl)ethenyl]-5-cyano-1-(3-methylphenyl)-6-oxopyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 126205077 |
| Molecular Formula | C21H13ClN4O5 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-[(Z)-2-(2-chloro-5-nitrophenyl)ethenyl]-5-cyano-1-(3-methylphenyl)-6-oxopyridazine-3-carboxylic acid |
| SMILES | Cc1cccc(-n2nc(C(=O)O)c(/C=C\c3cc([N+](=O)[O-])ccc3Cl)c(C#N)c2=O)c1 |
| InChI | InChI=1S/C21H13ClN4O5/c1-12-3-2-4-14(9-12)25-20(27)17(11-23)16(19(24-25)21(28)29)7-5-13-10-15(26(30)31)6-8-18(13)22/h2-10H,1H3,(H,28,29)/b7-5- |
| InChIKey | LYXMIRRGBDIWSB-ALCCZGGFSA-N |
| XLogP | 3.84 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_D(5)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|