C14H11F2N3O2 — CID 82591104
1-(2,5-difluorophenyl)-4-oxo-6,7-dihydro-5H-indazole-3-carboxamide (PubChem CID 82591104) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-4-oxo-6,7-dihydro-5H-indazole-3-carboxamide.
| Compound Name | 1-(2,5-difluorophenyl)-4-oxo-6,7-dihydro-5H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 82591104 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(2,5-difluorophenyl)-4-oxo-6,7-dihydro-5H-indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2cc(F)ccc2F)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C14H11F2N3O2/c15-7-4-5-8(16)10(6-7)19-9-2-1-3-11(20)12(9)13(18-19)14(17)21/h4-6H,1-3H2,(H2,17,21) |
| InChIKey | VIOZCQWAIKTQGL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |