C16H16N4O2 — CID 82591820
2-[1-(4-methyl-3-nitrophenyl)-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile (PubChem CID 82591820) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[1-(4-methyl-3-nitrophenyl)-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile.
| Compound Name | 2-[1-(4-methyl-3-nitrophenyl)-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile |
|---|---|
| PubChem CID | 82591820 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[1-(4-methyl-3-nitrophenyl)-4,5,6,7-tetrahydroindazol-4-yl]acetonitrile |
| SMILES | Cc1ccc(-n2ncc3c2CCCC3CC#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O2/c1-11-5-6-13(9-16(11)20(21)22)19-15-4-2-3-12(7-8-17)14(15)10-18-19/h5-6,9-10,12H,2-4,7H2,1H3 |
| InChIKey | KHQQZJJUMHXHIN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|