C9H13F3N4 — CID 82620222
1-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]piperazine (PubChem CID 82620222) has the molecular formula C9H13F3N4 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]piperazine.
| Compound Name | 1-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]piperazine |
|---|---|
| PubChem CID | 82620222 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]piperazine |
| SMILES | FC(F)(F)c1[nH]ncc1CN1CCNCC1 |
| InChI | InChI=1S/C9H13F3N4/c10-9(11,12)8-7(5-14-15-8)6-16-3-1-13-2-4-16/h5,13H,1-4,6H2,(H,14,15) |
| InChIKey | VIYGBJWNWSESQJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |