C10H22N2 — CID 82653251
(2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-amine (PubChem CID 82653251) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-amine.
| Compound Name | (2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 82653251 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-amine |
| SMILES | CC(C)(C)C[C@@H]1C[C@@H](N)CCN1 |
| InChI | InChI=1S/C10H22N2/c1-10(2,3)7-9-6-8(11)4-5-12-9/h8-9,12H,4-7,11H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | IPBPEUQXQGXTMM-IUCAKERBSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |