C7H11ClN2O — CID 82653619
1-(5-chloro-3-ethyl-1,2-oxazol-4-yl)ethanamine (PubChem CID 82653619) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-(5-chloro-3-ethyl-1,2-oxazol-4-yl)ethanamine.
| Compound Name | 1-(5-chloro-3-ethyl-1,2-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82653619 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1-(5-chloro-3-ethyl-1,2-oxazol-4-yl)ethanamine |
| SMILES | CCc1noc(Cl)c1C(C)N |
| InChI | InChI=1S/C7H11ClN2O/c1-3-5-6(4(2)9)7(8)11-10-5/h4H,3,9H2,1-2H3 |
| InChIKey | PYTMGSZTQHNOBF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |