C11H19N3 — CID 82656870
1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl]piperazine (PubChem CID 82656870) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl]piperazine.
| Compound Name | 1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl]piperazine |
|---|---|
| PubChem CID | 82656870 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-[(2,4-dimethyl-1H-pyrrol-3-yl)methyl]piperazine |
| SMILES | Cc1c[nH]c(C)c1CN1CCNCC1 |
| InChI | InChI=1S/C11H19N3/c1-9-7-13-10(2)11(9)8-14-5-3-12-4-6-14/h7,12-13H,3-6,8H2,1-2H3 |
| InChIKey | NXKFJQMUVNDHNY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |