C8H6ClN3O — CID 82657503
4-chloro-7-methylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde (PubChem CID 82657503) has the molecular formula C8H6ClN3O and a molecular weight of 195.61 g/mol. Its IUPAC name is 4-chloro-7-methylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-7-methylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 82657503 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 4-chloro-7-methylpyrrolo[2,3-d]pyrimidine-5-carbaldehyde |
| SMILES | Cn1cc(C=O)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C8H6ClN3O/c1-12-2-5(3-13)6-7(9)10-4-11-8(6)12/h2-4H,1H3 |
| InChIKey | CIEYPMRLILCTMZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|