C14H17NO2S — CID 82666659
7-(5-methoxy-1-benzothiophen-2-yl)-1,4-oxazepane (PubChem CID 82666659) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 7-(5-methoxy-1-benzothiophen-2-yl)-1,4-oxazepane.
| Compound Name | 7-(5-methoxy-1-benzothiophen-2-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 82666659 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 7-(5-methoxy-1-benzothiophen-2-yl)-1,4-oxazepane |
| SMILES | COc1ccc2sc(C3CCNCCO3)cc2c1 |
| InChI | InChI=1S/C14H17NO2S/c1-16-11-2-3-13-10(8-11)9-14(18-13)12-4-5-15-6-7-17-12/h2-3,8-9,12,15H,4-7H2,1H3 |
| InChIKey | BWRFCBUCMYCKQX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |