C9H16N4 — CID 82668736
1-ethyl-2-(1H-imidazol-2-yl)piperazine (PubChem CID 82668736) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-ethyl-2-(1H-imidazol-2-yl)piperazine.
| Compound Name | 1-ethyl-2-(1H-imidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 82668736 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-ethyl-2-(1H-imidazol-2-yl)piperazine |
| SMILES | CCN1CCNCC1c1ncc[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-2-13-6-5-10-7-8(13)9-11-3-4-12-9/h3-4,8,10H,2,5-7H2,1H3,(H,11,12) |
| InChIKey | HTSARYGPGGALSF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |