About 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole
2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 82669209) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole.
Analyze 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole (CID 82669209) is 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole is CC1CNCCN1C1=NCCS1.
What is the InChIKey of 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is UOCAHIUAUXNVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-7-6-9-2-4-11(7)8-10-3-5-12-8/h7,9H,2-6H2,1H3.
What are the key properties of 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole?
2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 185.30 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpiperazin-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 82669209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).