C14H12ClN3SSe — CID 82687532
N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 82687532) has the molecular formula C14H12ClN3SSe and a molecular weight of 368.75 g/mol. Its IUPAC name is N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 82687532 |
| Molecular Formula | C14H12ClN3SSe |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | N-(2-chloro-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | Clc1cc2c(s1)CCCC2Nc1cccc2c1N=[Se]=N2 |
| InChI | InChI=1S/C14H12ClN3SSe/c15-13-7-8-9(3-2-6-12(8)19-13)16-10-4-1-5-11-14(10)18-20-17-11/h1,4-5,7,9,16H,2-3,6H2 |
| InChIKey | SUZOVGUYRPENEL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|