C15H19BrFNO3 — CID 82689439
[4-(2-bromoethoxy)piperidin-1-yl]-(4-fluoro-3-methoxyphenyl)methanone (PubChem CID 82689439) has the molecular formula C15H19BrFNO3 and a molecular weight of 360.22 g/mol. Its IUPAC name is [4-(2-bromoethoxy)piperidin-1-yl]-(4-fluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-(2-bromoethoxy)piperidin-1-yl]-(4-fluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 82689439 |
| Molecular Formula | C15H19BrFNO3 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | [4-(2-bromoethoxy)piperidin-1-yl]-(4-fluoro-3-methoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(OCCBr)CC2)ccc1F |
| InChI | InChI=1S/C15H19BrFNO3/c1-20-14-10-11(2-3-13(14)17)15(19)18-7-4-12(5-8-18)21-9-6-16/h2-3,10,12H,4-9H2,1H3 |
| InChIKey | PQCKZQNWYAEFHG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|