C15H19ClFNO2 — CID 82701395
[4-(2-chloroethoxy)piperidin-1-yl]-(4-fluoro-3-methylphenyl)methanone (PubChem CID 82701395) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is [4-(2-chloroethoxy)piperidin-1-yl]-(4-fluoro-3-methylphenyl)methanone.
| Compound Name | [4-(2-chloroethoxy)piperidin-1-yl]-(4-fluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 82701395 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [4-(2-chloroethoxy)piperidin-1-yl]-(4-fluoro-3-methylphenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(OCCCl)CC2)ccc1F |
| InChI | InChI=1S/C15H19ClFNO2/c1-11-10-12(2-3-14(11)17)15(19)18-7-4-13(5-8-18)20-9-6-16/h2-3,10,13H,4-9H2,1H3 |
| InChIKey | CTHHYQFFJHCCIV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|