C15H20ClNS — CID 82689681
2-chloro-N-(cyclohex-3-en-1-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82689681) has the molecular formula C15H20ClNS and a molecular weight of 281.85 g/mol. Its IUPAC name is 2-chloro-N-(cyclohex-3-en-1-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-chloro-N-(cyclohex-3-en-1-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82689681 |
| Molecular Formula | C15H20ClNS |
| Molecular Weight | 281.85 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-chloro-N-(cyclohex-3-en-1-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Clc1cc2c(s1)CCCC2NCC1CC=CCC1 |
| InChI | InChI=1S/C15H20ClNS/c16-15-9-12-13(7-4-8-14(12)18-15)17-10-11-5-2-1-3-6-11/h1-2,9,11,13,17H,3-8,10H2 |
| InChIKey | MIFHOOHSMOWCGJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|