C17H21IN2O — CID 82692224
1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3,5-diethyl-4-iodopyrazole (PubChem CID 82692224) has the molecular formula C17H21IN2O and a molecular weight of 396.27 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3,5-diethyl-4-iodopyrazole.
| Compound Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3,5-diethyl-4-iodopyrazole |
|---|---|
| PubChem CID | 82692224 |
| Molecular Formula | C17H21IN2O |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-3,5-diethyl-4-iodopyrazole |
| SMILES | CCc1nn(CCc2ccc3c(c2)CCO3)c(CC)c1I |
| InChI | InChI=1S/C17H21IN2O/c1-3-14-17(18)15(4-2)20(19-14)9-7-12-5-6-16-13(11-12)8-10-21-16/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | MDWZYMITYRVIOA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|