C14H15Cl2IN2 — CID 82702883
1-[(3,4-dichlorophenyl)methyl]-3,5-diethyl-4-iodopyrazole (PubChem CID 82702883) has the molecular formula C14H15Cl2IN2 and a molecular weight of 409.10 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,5-diethyl-4-iodopyrazole.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,5-diethyl-4-iodopyrazole |
|---|---|
| PubChem CID | 82702883 |
| Molecular Formula | C14H15Cl2IN2 |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,5-diethyl-4-iodopyrazole |
| SMILES | CCc1nn(Cc2ccc(Cl)c(Cl)c2)c(CC)c1I |
| InChI | InChI=1S/C14H15Cl2IN2/c1-3-12-14(17)13(4-2)19(18-12)8-9-5-6-10(15)11(16)7-9/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | UQLXNBVREWBWEB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|