C14H21IN4 — CID 82703265
3,5-diethyl-1-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-4-iodopyrazole (PubChem CID 82703265) has the molecular formula C14H21IN4 and a molecular weight of 372.25 g/mol. Its IUPAC name is 3,5-diethyl-1-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-4-iodopyrazole.
| Compound Name | 3,5-diethyl-1-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-4-iodopyrazole |
|---|---|
| PubChem CID | 82703265 |
| Molecular Formula | C14H21IN4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3,5-diethyl-1-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-4-iodopyrazole |
| SMILES | CCc1cc(Cn2nc(CC)c(I)c2CC)n(C)n1 |
| InChI | InChI=1S/C14H21IN4/c1-5-10-8-11(18(4)16-10)9-19-13(7-3)14(15)12(6-2)17-19/h8H,5-7,9H2,1-4H3 |
| InChIKey | AVLWHSPSQYYQNM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|