C15H23IN4 — CID 82702643
1-[(1,3-diethylpyrazol-5-yl)methyl]-3,5-diethyl-4-iodopyrazole (PubChem CID 82702643) has the molecular formula C15H23IN4 and a molecular weight of 386.28 g/mol. Its IUPAC name is 1-[(1,3-diethylpyrazol-5-yl)methyl]-3,5-diethyl-4-iodopyrazole.
| Compound Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]-3,5-diethyl-4-iodopyrazole |
|---|---|
| PubChem CID | 82702643 |
| Molecular Formula | C15H23IN4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]-3,5-diethyl-4-iodopyrazole |
| SMILES | CCc1cc(Cn2nc(CC)c(I)c2CC)n(CC)n1 |
| InChI | InChI=1S/C15H23IN4/c1-5-11-9-12(19(8-4)17-11)10-20-14(7-3)15(16)13(6-2)18-20/h9H,5-8,10H2,1-4H3 |
| InChIKey | JFSAGLOQAPUWDW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|