C11H21N3O — CID 82693019
3-amino-2-(3,5-diethylpyrazol-1-yl)butan-1-ol (PubChem CID 82693019) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-amino-2-(3,5-diethylpyrazol-1-yl)butan-1-ol.
| Compound Name | 3-amino-2-(3,5-diethylpyrazol-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 82693019 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 3-amino-2-(3,5-diethylpyrazol-1-yl)butan-1-ol |
| SMILES | CCc1cc(CC)n(C(CO)C(C)N)n1 |
| InChI | InChI=1S/C11H21N3O/c1-4-9-6-10(5-2)14(13-9)11(7-15)8(3)12/h6,8,11,15H,4-5,7,12H2,1-3H3 |
| InChIKey | NCVYYLNIZCEDML-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |