C11H20N4O — CID 82695392
2-(3,5-diethylpyrazol-1-yl)-N'-hydroxybutanimidamide (PubChem CID 82695392) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(3,5-diethylpyrazol-1-yl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(3,5-diethylpyrazol-1-yl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 82695392 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-(3,5-diethylpyrazol-1-yl)-N'-hydroxybutanimidamide |
| SMILES | CCc1cc(CC)n(C(CC)/C(N)=N/O)n1 |
| InChI | InChI=1S/C11H20N4O/c1-4-8-7-9(5-2)15(13-8)10(6-3)11(12)14-16/h7,10,16H,4-6H2,1-3H3,(H2,12,14) |
| InChIKey | XVUORFKQGNBTBI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|