C11H16N2O2 — CID 82693468
(E)-4-(3,5-diethylpyrazol-1-yl)but-2-enoic acid (PubChem CID 82693468) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (E)-4-(3,5-diethylpyrazol-1-yl)but-2-enoic acid.
| Compound Name | (E)-4-(3,5-diethylpyrazol-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 82693468 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (E)-4-(3,5-diethylpyrazol-1-yl)but-2-enoic acid |
| SMILES | CCc1cc(CC)n(C/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C11H16N2O2/c1-3-9-8-10(4-2)13(12-9)7-5-6-11(14)15/h5-6,8H,3-4,7H2,1-2H3,(H,14,15)/b6-5+ |
| InChIKey | COOMAWUPUWVBRE-AATRIKPKSA-N |
| XLogP | 1.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|