C15H20N4O2 — CID 82698681
(E)-3-[5-(3,5-diethylpyrazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 82698681) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (E)-3-[5-(3,5-diethylpyrazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(3,5-diethylpyrazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82698681 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (E)-3-[5-(3,5-diethylpyrazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | CCc1cc(CC)n(-c2c(/C=C/C(=O)O)c(C)nn2C)n1 |
| InChI | InChI=1S/C15H20N4O2/c1-5-11-9-12(6-2)19(17-11)15-13(7-8-14(20)21)10(3)16-18(15)4/h7-9H,5-6H2,1-4H3,(H,20,21)/b8-7+ |
| InChIKey | IILFHWRUXCALLI-BQYQJAHWSA-N |
| XLogP | 2.14 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|