C15H13ClN4O2 — CID 66859275
(E)-3-[5-(3-chloroindazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 66859275) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is (E)-3-[5-(3-chloroindazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(3-chloroindazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66859275 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (E)-3-[5-(3-chloroindazol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(-n2nc(Cl)c3ccccc32)c1/C=C/C(=O)O |
| InChI | InChI=1S/C15H13ClN4O2/c1-9-10(7-8-13(21)22)15(19(2)17-9)20-12-6-4-3-5-11(12)14(16)18-20/h3-8H,1-2H3,(H,21,22)/b8-7+ |
| InChIKey | XYBXPQGYUXXVMG-BQYQJAHWSA-N |
| XLogP | 2.82 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|