C14H21N3O2 — CID 29018716
(E)-3-[5-(azepan-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 29018716) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (E)-3-[5-(azepan-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(azepan-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 29018716 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (E)-3-[5-(azepan-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(N2CCCCCC2)c1/C=C/C(=O)O |
| InChI | InChI=1S/C14H21N3O2/c1-11-12(7-8-13(18)19)14(16(2)15-11)17-9-5-3-4-6-10-17/h7-8H,3-6,9-10H2,1-2H3,(H,18,19)/b8-7+ |
| InChIKey | JEJCPQYMWGSPIS-BQYQJAHWSA-N |
| XLogP | 2.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|