C14H22N4O2 — CID 77002743
3-[5-(3,4-dimethylpiperazin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 77002743) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-[5-(3,4-dimethylpiperazin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(3,4-dimethylpiperazin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77002743 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-[5-(3,4-dimethylpiperazin-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(N2CCN(C)C(C)C2)c1C=CC(=O)O |
| InChI | InChI=1S/C14H22N4O2/c1-10-9-18(8-7-16(10)3)14-12(5-6-13(19)20)11(2)15-17(14)4/h5-6,10H,7-9H2,1-4H3,(H,19,20) |
| InChIKey | JTYUWBLGXUTKGQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|