C12H19N3O — CID 79189203
5-(3,4-dimethylpyrrolidin-1-yl)-1,3-dimethylpyrazole-4-carbaldehyde (PubChem CID 79189203) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-(3,4-dimethylpyrrolidin-1-yl)-1,3-dimethylpyrazole-4-carbaldehyde.
| Compound Name | 5-(3,4-dimethylpyrrolidin-1-yl)-1,3-dimethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 79189203 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 5-(3,4-dimethylpyrrolidin-1-yl)-1,3-dimethylpyrazole-4-carbaldehyde |
| SMILES | Cc1nn(C)c(N2CC(C)C(C)C2)c1C=O |
| InChI | InChI=1S/C12H19N3O/c1-8-5-15(6-9(8)2)12-11(7-16)10(3)13-14(12)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | MSDQQONUKQSORU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|