C14H16F2N4 — CID 82693934
4-(3,5-diethylpyrazol-1-yl)-3,5-difluorobenzenecarboximidamide (PubChem CID 82693934) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-(3,5-diethylpyrazol-1-yl)-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(3,5-diethylpyrazol-1-yl)-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 82693934 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(3,5-diethylpyrazol-1-yl)-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(-n2nc(CC)cc2CC)c(F)c1 |
| InChI | InChI=1S/C14H16F2N4/c1-3-9-7-10(4-2)20(19-9)13-11(15)5-8(14(17)18)6-12(13)16/h5-7H,3-4H2,1-2H3,(H3,17,18) |
| InChIKey | KAILJIUSLCJFNP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|