C9H16N4 — CID 82695399
2-(3,5-diethylpyrazol-1-yl)ethanimidamide (PubChem CID 82695399) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(3,5-diethylpyrazol-1-yl)ethanimidamide.
| Compound Name | 2-(3,5-diethylpyrazol-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 82695399 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-(3,5-diethylpyrazol-1-yl)ethanimidamide |
| SMILES | [H]/N=C(\N)Cn1nc(CC)cc1CC |
| InChI | InChI=1S/C9H16N4/c1-3-7-5-8(4-2)13(12-7)6-9(10)11/h5H,3-4,6H2,1-2H3,(H3,10,11) |
| InChIKey | WKSYHCHBXWTFBE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|