C13H23ClN2O2S — CID 82694926
1-(3,3-dimethylbutyl)-3,5-diethylpyrazole-4-sulfonyl chloride (PubChem CID 82694926) has the molecular formula C13H23ClN2O2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole-4-sulfonyl chloride.
| Compound Name | 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 82694926 |
| Molecular Formula | C13H23ClN2O2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,5-diethylpyrazole-4-sulfonyl chloride |
| SMILES | CCc1nn(CCC(C)(C)C)c(CC)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H23ClN2O2S/c1-6-10-12(19(14,17)18)11(7-2)16(15-10)9-8-13(3,4)5/h6-9H2,1-5H3 |
| InChIKey | CTZZPWSNWBBHNW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |