C14H19N3O2S — CID 82695711
2-[1-(4-amino-1,3-benzothiazol-5-yl)piperidin-4-yl]oxyethanol (PubChem CID 82695711) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[1-(4-amino-1,3-benzothiazol-5-yl)piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-(4-amino-1,3-benzothiazol-5-yl)piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 82695711 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[1-(4-amino-1,3-benzothiazol-5-yl)piperidin-4-yl]oxyethanol |
| SMILES | Nc1c(N2CCC(OCCO)CC2)ccc2scnc12 |
| InChI | InChI=1S/C14H19N3O2S/c15-13-11(1-2-12-14(13)16-9-20-12)17-5-3-10(4-6-17)19-8-7-18/h1-2,9-10,18H,3-8,15H2 |
| InChIKey | VDHOBDUQBOGLFS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|