C14H22N4O2 — CID 82695930
4-[[4-(2-hydroxyethoxy)piperidin-1-yl]methyl]pyridine-2-carboximidamide (PubChem CID 82695930) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyethoxy)piperidin-1-yl]methyl]pyridine-2-carboximidamide.
| Compound Name | 4-[[4-(2-hydroxyethoxy)piperidin-1-yl]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 82695930 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-[[4-(2-hydroxyethoxy)piperidin-1-yl]methyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CN2CCC(OCCO)CC2)ccn1 |
| InChI | InChI=1S/C14H22N4O2/c15-14(16)13-9-11(1-4-17-13)10-18-5-2-12(3-6-18)20-8-7-19/h1,4,9,12,19H,2-3,5-8,10H2,(H3,15,16) |
| InChIKey | RIBKFRVQBYNWRQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|