C13H22N2O3 — CID 82696071
2-[1-[2-amino-1-(furan-2-yl)ethyl]piperidin-4-yl]oxyethanol (PubChem CID 82696071) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[1-[2-amino-1-(furan-2-yl)ethyl]piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-[2-amino-1-(furan-2-yl)ethyl]piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 82696071 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-[1-[2-amino-1-(furan-2-yl)ethyl]piperidin-4-yl]oxyethanol |
| SMILES | NCC(c1ccco1)N1CCC(OCCO)CC1 |
| InChI | InChI=1S/C13H22N2O3/c14-10-12(13-2-1-8-18-13)15-5-3-11(4-6-15)17-9-7-16/h1-2,8,11-12,16H,3-7,9-10,14H2 |
| InChIKey | QCUKKDYLBWDGFN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |