C11H19N3O4S2 — CID 82698827
1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-sulfonamide (PubChem CID 82698827) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-sulfonamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 82698827 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-sulfonamide |
| SMILES | CCc1nn(C2CCS(=O)(=O)C2)c(CC)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H19N3O4S2/c1-3-9-11(20(12,17)18)10(4-2)14(13-9)8-5-6-19(15,16)7-8/h8H,3-7H2,1-2H3,(H2,12,17,18) |
| InChIKey | GYCJRYFYHBNVQK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |