C12H18N2O4S — CID 107430847
1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-carboxylic acid (PubChem CID 107430847) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-carboxylic acid.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107430847 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3,5-diethylpyrazole-4-carboxylic acid |
| SMILES | CCc1nn(C2CCS(=O)(=O)C2)c(CC)c1C(=O)O |
| InChI | InChI=1S/C12H18N2O4S/c1-3-9-11(12(15)16)10(4-2)14(13-9)8-5-6-19(17,18)7-8/h8H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | DYCFHXZSLNXFMX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |